CAS 1190312-56-1

3-Iodo-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile

Description:

3-Iodo-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. The presence of an iodine atom at the 3-position and a cyano group at the 6-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential for various chemical reactions, including nucleophilic substitutions and coupling reactions, making it of interest in the synthesis of pharmaceuticals and agrochemicals. The cyano group can also serve as a versatile functional handle for further modifications. Additionally, the compound's iodine substituent may enhance its biological activity, as halogenated compounds often exhibit unique pharmacological properties. Overall, 3-Iodo-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile is a valuable compound for research and development in organic synthesis and drug discovery.

Formula: C₈H₄IN₃

InChI: InChI=1S/C8H4IN3/c9-6-4-11-7-1-5(2-10)3-12-8(6)7/h1,3-4,11H

InChI key: InChIKey=WXZYWQXQGKFWCN-UHFFFAOYSA-N

SMILES: IC=1C=2C(=CC(C#N)=CN2)NC1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile, 3-iodo-
• 3-Iodo-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile

1H-Pyrrolo[3,2-b]pyridine-6-carbonitrile, 3-iodo-

CAS: 1190312-56-1

Formula: C₈H₄IN₃

Molecular weight: 269.0419

Ref: IN-DA000HJR