CAS 1190312-57-2

4-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine

Description:

4-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a fluorine atom at the 4-position of the pyrrole ring contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound typically exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Its amine functional group can engage in hydrogen bonding, influencing its interactions with biological targets. The compound is of interest in pharmaceutical research, particularly for its potential as a building block in the synthesis of bioactive molecules. Additionally, its structural features may impart specific pharmacological properties, making it a candidate for further investigation in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₆FN₃

InChI: InChI=1S/C7H6FN3/c8-7-6-4(9)3-11-5(6)1-2-10-7/h1-3,11H,9H2

InChI key: InChIKey=LCYZBFHVARGVPP-UHFFFAOYSA-N

SMILES: FC1=C2C(=CC=N1)NC=C2N

Synonyms:

• 4-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine
• 1H-Pyrrolo[3,2-c]pyridin-3-amine, 4-fluoro-

1H-Pyrrolo[3,2-c]pyridin-3-amine, 4-fluoro-

CAS: 1190312-57-2

Formula: C₇H₆FN₃

Molecular weight: 151.141

Ref: IN-DA000HJQ