CAS 1190312-72-1

7-Cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid

Description:

7-Cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a cyano group (-CN) and a carboxylic acid group (-COOH), enhancing its reactivity and potential for forming hydrogen bonds. The presence of the cyano group can influence the compound's electronic properties, making it a candidate for various applications in medicinal chemistry and material science. Its structural framework allows for potential interactions with biological targets, which may lead to pharmacological activities. Additionally, the compound's solubility and stability can be affected by the functional groups present, influencing its behavior in different solvents and under varying pH conditions. As a result, 7-Cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is of interest for research in drug development and synthetic chemistry, where its unique structure may provide pathways for novel therapeutic agents or materials.

Formula: C₉H₅N₃O₂

InChI: InChI=1S/C9H5N3O2/c10-3-5-1-2-11-8-6(9(13)14)4-12-7(5)8/h1-2,4,12H,(H,13,14)

InChI key: InChIKey=NBVINOOBXKGOAI-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(=C(C#N)C=CN2)NC1

Synonyms:

• 7-Cyano-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid
• 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 7-cyano-

1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 7-cyano-

CAS: 1190312-72-1

Formula: C₉H₅N₃O₂

Molecular weight: 187.1549

Ref: IN-DA000HJH