CymitQuimica logo

CAS 1190312-76-5

:

Methyl 6-chloro-2,3-dihydro-2-oxo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate

Description:
Methyl 6-chloro-2,3-dihydro-2-oxo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate is a chemical compound characterized by its complex bicyclic structure, which includes a pyrrolopyridine framework. This compound features a chloro substituent at the 6-position and a carboxylate ester functional group, contributing to its reactivity and potential biological activity. The presence of the carbonyl group (2-oxo) indicates that it may participate in various chemical reactions, such as nucleophilic attacks or condensation reactions. The methyl ester group enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. Its unique structure may also suggest potential pharmacological properties, warranting further investigation into its biological activity. As with many heterocyclic compounds, it may exhibit interesting interactions with biological targets, making it a candidate for drug development. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C9H7ClN2O3
InChI:InChI=1S/C9H7ClN2O3/c1-15-9(14)5-2-6(10)11-8-4(5)3-7(13)12-8/h2H,3H2,1H3,(H,11,12,13)
InChI key:InChIKey=OZOIXOGLWBMUMV-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(NC(=O)C2)=NC(Cl)=C1
Synonyms:
  • Methyl 6-chloro-2,3-dihydro-2-oxo-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
  • 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 6-chloro-2,3-dihydro-2-oxo-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.