CymitQuimica logo

CAS 1190313-01-9

:

1,3-Dihydro-6-methyl-2H-pyrrolo[3,2-c]pyridin-2-one

Description:
1,3-Dihydro-6-methyl-2H-pyrrolo[3,2-c]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine functionalities. This compound features a dihydropyrrole ring fused to a pyridine ring, with a methyl group at the 6-position. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the carbonyl group in the pyrrolidine ring contributes to its reactivity, making it a potential candidate for various chemical transformations. The compound may also display biological activity, which is of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it a subject of research in drug discovery. As with many heterocycles, the compound's properties, such as stability and reactivity, can be influenced by substituents and the overall electronic environment of the molecule.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-2-7-6(4-9-5)3-8(11)10-7/h2,4H,3H2,1H3,(H,10,11)
InChI key:InChIKey=VPAFZJPLGNWYGP-UHFFFAOYSA-N
SMILES:O=C1CC=2C(N1)=CC(C)=NC2
Synonyms:
  • 2H-Pyrrolo[3,2-c]pyridin-2-one, 1,3-dihydro-6-methyl-
  • 1,3-Dihydro-6-methyl-2H-pyrrolo[3,2-c]pyridin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.