CAS 1190313-05-3
:3-Amino-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid
Description:
3-Amino-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features an amino group and a carboxylic acid functional group, which contribute to its potential as a building block in medicinal chemistry and drug development. The presence of these functional groups suggests that it may exhibit polar characteristics, influencing its solubility and reactivity. The compound's unique bicyclic structure may also impart specific biological activities, making it of interest in pharmacological research. Additionally, its molecular framework allows for various substitution patterns, which can be explored to enhance its therapeutic properties. As with many heterocycles, it may participate in diverse chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile compound in synthetic organic chemistry. Overall, 3-Amino-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid represents a significant structure for further exploration in both academic and industrial applications.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-5-3-10-6-1-4(8(12)13)2-11-7(5)6/h1-3,10H,9H2,(H,12,13)
InChI key:InChIKey=QBDZOCFHIQYVQY-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CC(C(O)=O)=CN2)NC1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 3-amino-
- 3-Amino-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
