CymitQuimica logo

CAS 1190313-12-2

:

3-Bromo-5-fluoro-1H-pyrrolo[3,2-b]pyridine

Description:
3-Bromo-5-fluoro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and fluorine substituents enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits moderate to high polarity due to the electronegative halogen atoms, influencing its solubility in various solvents. Its structure allows for potential interactions with biological targets, making it of interest in drug discovery. Additionally, the compound may participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions, which are valuable in synthetic organic chemistry. The specific arrangement of atoms and functional groups in 3-Bromo-5-fluoro-1H-pyrrolo[3,2-b]pyridine can also affect its electronic properties, making it a candidate for studies in electronic materials or as a building block in complex organic synthesis. Overall, its unique structural features and reactivity profile make it a compound of significant interest in various fields of research.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-4-3-10-5-1-2-6(9)11-7(4)5/h1-3,10H
InChI key:InChIKey=KJOGOILKOIOAMX-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC=C(F)N2)NC1
Synonyms:
  • 3-Bromo-5-fluoro-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-5-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.