CAS 1190313-15-5

2-Methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid

Description:

2-Methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, enhancing its acidity and potential for forming hydrogen bonds, which can influence its solubility and reactivity. The presence of the methyl group at the 2-position of the pyrrole ring can affect the electronic distribution within the molecule, potentially impacting its biological activity and interactions with other substances. As a member of the pyrrolopyridine family, it may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its structural complexity allows for various synthetic modifications, which can lead to derivatives with tailored properties for specific applications. Overall, 2-Methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid is notable for its unique structure and potential utility in research and development within the fields of organic and medicinal chemistry.

Formula: C₉H₈N₂O₂

InChI: InChI=1S/C9H8N2O2/c1-5-2-7-8(11-5)3-6(4-10-7)9(12)13/h2-4,11H,1H3,(H,12,13)

InChI key: InChIKey=TXBZMNCJUSNWPK-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=C2C(=NC1)C=C(C)N2

Synonyms:

• 2-Methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid
• 1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 2-methyl-

1H-Pyrrolo[3,2-b]pyridine-6-carboxylic acid, 2-methyl-

CAS: 1190313-15-5

Formula: C₉H₈N₂O₂

Purity: %

Molecular weight: 176.1720

Ref: IN-DA000HK9

2-Methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid

CAS: 1190313-15-5

2-Methyl-1H-pyrrolo[3,2-b]pyridine-6-carboxylic acid

Purity: 98%

Molecular weight: 176.17g/mol

Ref: 54-OR1001172

2-METHYL-1H-PYRROLO[3,2-B]PYRIDINE-6-CARBOXYLIC ACID

CAS: 1190313-15-5

Purity: 98%

Molecular weight: 176.1750031

Ref: 10-F857317