CymitQuimica logo

CAS 1190313-25-7

:

3-Bromo-6-methoxy-1H-pyrrolo[3,2-c]pyridine

Description:
3-Bromo-6-methoxy-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. The presence of a bromine atom at the 3-position and a methoxy group at the 6-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the bromine and methoxy substituents, which can influence its interaction with biological targets. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system of the fused rings. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a valuable intermediate in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, particularly those containing halogens.
Formula:C8H7BrN2O
InChI:InChI=1S/C8H7BrN2O/c1-12-8-2-7-5(3-11-8)6(9)4-10-7/h2-4,10H,1H3
InChI key:InChIKey=RSKVMFREGVZOSF-UHFFFAOYSA-N
SMILES:BrC=1C=2C(=CC(OC)=NC2)NC1
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 3-bromo-6-methoxy-
  • 3-Bromo-6-methoxy-1H-pyrrolo[3,2-c]pyridine
  • 3-Bromo-6-methoxy-5-azaindole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.