CAS 1190313-30-4

3-Chloro-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

3-Chloro-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both pyridine and pyrrole rings. This compound features a chlorine atom at the 3-position, a methoxy group at the 5-position, and a methyl group at the 4-position of the pyrrolopyridine framework. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the chlorine and methoxy substituents can influence the compound's solubility, reactivity, and interaction with biological targets. Additionally, the compound may exhibit unique electronic properties due to the conjugation within the aromatic system. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Understanding its characteristics is crucial for exploring its applications in pharmaceuticals or as a building block in organic synthesis.

Formula: C₉H₉ClN₂O

InChI: InChI=1S/C9H9ClN2O/c1-5-7(13-2)4-12-9-8(5)6(10)3-11-9/h3-4H,1-2H3,(H,11,12)

InChI key: InChIKey=OCFIUPCGFBUSKL-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC=C1OC)NC=C2Cl

Synonyms:

• 3-Chloro-5-methoxy-4-methyl-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 3-chloro-5-methoxy-4-methyl-

1H-Pyrrolo[2,3-b]pyridine, 3-chloro-5-methoxy-4-methyl-

CAS: 1190313-30-4

Formula: C₉H₉ClN₂O

Molecular weight: 196.6336

Ref: IN-DA000HK0