CymitQuimica logo

CAS 1190313-34-8

:

3-Amino-1H-pyrrolo[3,2-b]pyridin-6-ol

Description:
3-Amino-1H-pyrrolo[3,2-b]pyridin-6-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of an amino group and a hydroxyl group enhances its potential for hydrogen bonding, making it a polar molecule. This compound typically exhibits moderate solubility in polar solvents due to these functional groups. Its structure suggests potential biological activity, as many compounds with similar frameworks are known to interact with biological targets, making it of interest in medicinal chemistry. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, due to the reactivity of the amino and hydroxyl groups. Additionally, its molecular structure may allow for the formation of derivatives, which can be explored for enhanced pharmacological properties. Overall, 3-Amino-1H-pyrrolo[3,2-b]pyridin-6-ol represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-5-3-9-6-1-4(11)2-10-7(5)6/h1-3,9,11H,8H2
InChI key:InChIKey=ZHGOTIVYHHHHRP-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=CC(O)=CN2
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridin-6-ol, 3-amino-
  • 3-Amino-1H-pyrrolo[3,2-b]pyridin-6-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.