CAS 1190313-58-6

4-Bromo-2-methyl-1H-pyrrolo[3,2-c]pyridine

Description:

4-Bromo-2-methyl-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 4-position and a methyl group at the 2-position of the pyrrole ring influences its reactivity and solubility. This compound typically exhibits moderate polarity due to the nitrogen atoms in the ring structures, which can participate in hydrogen bonding. It is often used in medicinal chemistry and research due to its potential biological activity, including antimicrobial and anticancer properties. The compound's structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its stability under standard laboratory conditions makes it suitable for further functionalization. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 4-Bromo-2-methyl-1H-pyrrolo[3,2-c]pyridine is a valuable compound in the field of organic chemistry and drug development.

Formula: C₈H₇BrN₂

InChI: InChI=1S/C8H7BrN2/c1-5-4-6-7(11-5)2-3-10-8(6)9/h2-4,11H,1H3

InChI key: InChIKey=MRVVDEPYSRDEIT-UHFFFAOYSA-N

SMILES: BrC1=C2C(NC(C)=C2)=CC=N1

Synonyms:

• 1H-Pyrrolo[3,2-c]pyridine, 4-bromo-2-methyl-
• 4-Bromo-2-methyl-1H-pyrrolo[3,2-c]pyridine

1H-Pyrrolo[3,2-c]pyridine, 4-bromo-2-methyl-

CAS: 1190313-58-6

Formula: C₈H₇BrN₂

Molecular weight: 211.0586

Ref: IN-DA000HL0