CymitQuimica logo

CAS 1190313-66-6

:

4-Bromo-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one

Description:
4-Bromo-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrolidine and a pyridine ring. The presence of a bromine atom at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a range of biological activities, making it of interest in drug discovery and development. Its molecular structure allows for various functional group modifications, which can enhance its pharmacological properties. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as temperature and light. Additionally, the presence of the carbonyl group in the structure may facilitate hydrogen bonding and interactions with biological targets. Overall, 4-Bromo-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C7H5BrN2O
InChI:InChI=1S/C7H5BrN2O/c8-7-4-3-6(11)10-5(4)1-2-9-7/h1-2H,3H2,(H,10,11)
InChI key:InChIKey=CBXVPOIXUKJUTE-UHFFFAOYSA-N
SMILES:BrC1=C2C(NC(=O)C2)=CC=N1
Synonyms:
  • 2H-Pyrrolo[3,2-c]pyridin-2-one, 4-bromo-1,3-dihydro-
  • 4-Bromo-1,3-dihydro-2H-pyrrolo[3,2-c]pyridin-2-one
  • 4-BroMo-5-aza-2-oxindole
  • 4-Bromo-1H-pyrrolo[3,2-c]pyridin-2(3H)-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.