CymitQuimica logo

CAS 1190313-68-8

:

3,6-Dinitro-1H-pyrrolo[3,2-b]pyridine

Description:
3,6-Dinitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of two nitro groups at the 3 and 6 positions enhances its reactivity and polar nature, making it a potential candidate for various chemical applications, including as a building block in organic synthesis and in the development of pharmaceuticals. This compound typically exhibits a solid state at room temperature and may have moderate solubility in polar solvents due to the nitro groups. Its structure suggests potential for hydrogen bonding and interactions with other molecules, which can influence its behavior in chemical reactions. Additionally, the presence of nitro groups may impart explosive characteristics under certain conditions, necessitating careful handling and storage. Overall, 3,6-Dinitro-1H-pyrrolo[3,2-b]pyridine is of interest in both academic research and industrial applications, particularly in the fields of medicinal chemistry and materials science.
Formula:C7H4N4O4
InChI:InChI=1S/C7H4N4O4/c12-10(13)4-1-5-7(9-2-4)6(3-8-5)11(14)15/h1-3,8H
InChI key:InChIKey=FHSWYAQOZWKGQA-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(=CC(N(=O)=O)=CN2)NC1
Synonyms:
  • 3,6-Dinitro-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 3,6-dinitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.