
CAS 1190313-80-4
:Methyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
Description:
Methyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a pyridine and a pyrrole ring. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 3-position of the pyrrole ring introduces unique electronic and steric effects, which can influence its chemical behavior and potential applications in medicinal chemistry. Typically, compounds of this nature may exhibit biological activity, making them of interest in drug development and synthesis. The molecular structure allows for various functionalization possibilities, which can be explored for enhancing pharmacological properties. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Methyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate represents a valuable scaffold in organic synthesis and pharmaceutical research.
Formula:C9H7ClN2O2
InChI:InChI=1S/C9H7ClN2O2/c1-14-9(13)5-2-3-11-8-7(5)6(10)4-12-8/h2-4H,1H3,(H,11,12)
InChI key:InChIKey=ZZPDDWLQFGSJCA-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(NC=C2Cl)=NC=C1
Synonyms:- Methyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
- 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 3-chloro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
methyl 3-chloro-1H-pyrrolo[2,3-b]pyridine-4-carboxylate
CAS:Formula:C9H7ClN2O2Molecular weight:210.6171
