CAS 1190313-82-6

3-Chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

3-Chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 3-position and a methyl group at the 4-position of the pyrrole ring influences its reactivity and solubility. This compound typically exhibits moderate polarity due to the electronegative chlorine atom, which can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Its structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial applications. Overall, 3-Chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine is a versatile compound with potential applications in various fields of chemistry and pharmacology.

Formula: C₈H₇ClN₂

InChI: InChI=1S/C8H7ClN2/c1-5-2-3-10-8-7(5)6(9)4-11-8/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=LANAIGJJNSNJJY-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC=C1)NC=C2Cl

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine, 3-chloro-4-methyl-
• 3-Chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine

3-Chloro-4-methyl-1H-pyrrolo[2,3-b]pyridine

CAS: 1190313-82-6

Formula: C₈H₇ClN₂

Molecular weight: 166.6076

Ref: IN-DA000HLZ