CAS 1190313-86-0

4-Fluoro-1H-pyrrolo[2,3-c]pyridin-3-amine

Description:

4-Fluoro-1H-pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine ring fused together. The presence of a fluorine atom at the 4-position of the pyrrole ring contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions due to the presence of the amino group. It is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyrrolo-pyridine framework can lead to compounds with significant pharmacological properties. The compound's molecular structure allows for interactions with biological targets, making it a candidate for further research in therapeutic applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₆FN₃

InChI: InChI=1S/C7H6FN3/c8-4-1-10-3-6-7(4)5(9)2-11-6/h1-3,11H,9H2

InChI key: InChIKey=OYFGXDQVJDRIFJ-UHFFFAOYSA-N

SMILES: FC1=C2C(=CN=C1)NC=C2N

Synonyms:

• 4-Fluoro-1H-pyrrolo[2,3-c]pyridin-3-amine
• 1H-Pyrrolo[2,3-c]pyridin-3-amine, 4-fluoro-

1H-Pyrrolo[2,3-c]pyridin-3-amine, 4-fluoro-

CAS: 1190313-86-0

Formula: C₇H₆FN₃

Molecular weight: 151.141

Ref: IN-DA000P4J