
CAS 1190313-95-1
:6-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid
Description:
6-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it a potential candidate for various biochemical applications, including as a building block in drug synthesis or as a ligand in coordination chemistry. The presence of the amino group enhances its solubility in polar solvents, while the carboxylic acid group can participate in hydrogen bonding and ionic interactions. Its structure suggests potential reactivity in electrophilic substitution reactions, and it may exhibit biological activity due to its ability to interact with biological targets. The compound's molecular framework allows for the possibility of forming derivatives that could enhance its pharmacological properties. Overall, 6-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid is of interest in medicinal chemistry and materials science due to its structural features and functional groups.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-4-1-6-7(11-2-4)5(3-10-6)8(12)13/h1-3,10H,9H2,(H,12,13)
InChI key:InChIKey=PCOSQINZTJLNOG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=CC(N)=CN2
Synonyms:- 6-Amino-1H-pyrrolo[3,2-b]pyridine-3-carboxylic acid
- 1H-Pyrrolo[3,2-b]pyridine-3-carboxylic acid, 6-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
