CAS 1190314-01-2

7-Methyl-1H-pyrrolo[2,3-c]pyridin-3-amine

Description:

7-Methyl-1H-pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methyl group at the 7-position and an amino group at the 3-position enhances its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often show biological activity. The compound's molecular interactions, stability, and reactivity can be influenced by the electronic effects of the methyl and amino substituents. Additionally, its CAS number, 1190314-01-2, allows for precise identification in chemical databases, facilitating research and development in various fields, including drug discovery and material science.

Formula: C₈H₉N₃

InChI: InChI=1S/C8H9N3/c1-5-8-6(2-3-10-5)7(9)4-11-8/h2-4,11H,9H2,1H3

InChI key: InChIKey=GBRBKCWGORHVGT-UHFFFAOYSA-N

SMILES: CC1=C2C(C(N)=CN2)=CC=N1

Synonyms:

• 1H-Pyrrolo[2,3-c]pyridin-3-amine, 7-methyl-
• 7-Methyl-1H-pyrrolo[2,3-c]pyridin-3-amine

1H-Pyrrolo[2,3-c]pyridin-3-amine, 7-methyl-

CAS: 1190314-01-2

Formula: C₈H₉N₃

Molecular weight: 147.1772

Ref: IN-DA000HLQ