CymitQuimica logo

CAS 1190314-02-3

:

1,3-Dihydro-4-methyl-2H-pyrrolo[3,2-c]pyridin-2-one

Description:
1,3-Dihydro-4-methyl-2H-pyrrolo[3,2-c]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and a pyridine ring. This compound features a dihydro configuration, indicating the presence of two hydrogen atoms that contribute to its saturation. The methyl group at the 4-position enhances its lipophilicity, potentially influencing its biological activity and solubility. The presence of the carbonyl group in the pyrrolidine ring contributes to its reactivity and may facilitate interactions with various biological targets. This compound is of interest in medicinal chemistry due to its potential pharmacological properties, including anti-inflammatory and neuroprotective effects. Its specific stereochemistry and functional groups can significantly affect its interactions in biological systems, making it a subject of study for drug development. As with many heterocycles, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the presence of substituents and the overall molecular conformation.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-6-4-8(11)10-7(6)2-3-9-5/h2-3H,4H2,1H3,(H,10,11)
InChI key:InChIKey=KQHIRDYWUSWWRT-UHFFFAOYSA-N
SMILES:CC1=C2C(NC(=O)C2)=CC=N1
Synonyms:
  • 1,3-Dihydro-4-methyl-2H-pyrrolo[3,2-c]pyridin-2-one
  • 2H-Pyrrolo[3,2-c]pyridin-2-one, 1,3-dihydro-4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.