CAS 1190314-09-0

4-Methoxy-3-nitro-1H-pyrrolo[3,2-c]pyridine

Description:

4-Methoxy-3-nitro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both pyridine and pyrrole rings. This compound features a methoxy group (-OCH3) and a nitro group (-NO2) at specific positions on the pyrrolopyridine framework, contributing to its chemical reactivity and potential biological activity. The presence of the methoxy group can influence the compound's solubility and electronic properties, while the nitro group may enhance its reactivity, making it of interest in various synthetic applications. Typically, compounds of this nature are studied for their potential pharmacological properties, including antimicrobial or anticancer activities. Additionally, the molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Overall, 4-Methoxy-3-nitro-1H-pyrrolo[3,2-c]pyridine represents a significant compound in medicinal chemistry and organic synthesis.

Formula: C₈H₇N₃O₃

InChI: InChI=1S/C8H7N3O3/c1-14-8-7-5(2-3-9-8)10-4-6(7)11(12)13/h2-4,10H,1H3

InChI key: InChIKey=SVQUXVKKVATWKK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CC=NC2OC

Synonyms:

• 4-Methoxy-3-nitro-1H-pyrrolo[3,2-c]pyridine
• 1H-Pyrrolo[3,2-c]pyridine, 4-methoxy-3-nitro-

1H-Pyrrolo[3,2-c]pyridine, 4-methoxy-3-nitro-

CAS: 1190314-09-0

Formula: C₈H₇N₃O₃

Molecular weight: 193.1595

Ref: IN-DA000HLL

4-Methoxy-3-nitro-1H-pyrrolo[3,2-c]pyridine

CAS: 1190314-09-0

Purity: 98%

Molecular weight: 193.1620026

Ref: 10-F766793