CAS 1190314-20-5

5-Hydroxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:

5-Hydroxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures. This compound features a hydroxyl group and a carboxylic acid functional group, contributing to its potential as a bioactive molecule. The presence of the methyl group enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting neurological or metabolic pathways. Its CAS number, 1190314-20-5, allows for precise identification in chemical databases. As with many heterocycles, the compound may exhibit interesting properties such as fluorescence or specific reactivity patterns, making it a subject of interest in both synthetic and medicinal chemistry research. Further studies would be necessary to elucidate its full range of biological activities and potential therapeutic applications.

Formula: C₉H₈N₂O₃

InChI: InChI=1S/C9H8N2O3/c1-4-6(12)3-11-8-7(4)5(2-10-8)9(13)14/h2-3,12H,1H3,(H,10,11)(H,13,14)

InChI key: InChIKey=MFNQGQQDCSETGA-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=NC=C(O)C2C

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-hydroxy-4-methyl-
• 5-Hydroxy-4-methyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 5-hydroxy-4-methyl-

CAS: 1190314-20-5

Formula: C₉H₈N₂O₃

Molecular weight: 192.1714

Ref: IN-DA000HLF