CymitQuimica logo

CAS 1190314-30-7

:

4-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol

Description:
4-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxyl group (-OH) at the 5-position and a methyl group (-CH3) at the 4-position of the pyrrole ring. The presence of these functional groups enhances its potential for hydrogen bonding and influences its solubility in various solvents. The molecular structure suggests that it may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry. Additionally, the compound's aromatic nature and the presence of nitrogen atoms in the ring system can contribute to its reactivity and stability under certain conditions. Its CAS number, 1190314-30-7, allows for easy identification in chemical databases and literature. Overall, 4-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol is a compound of interest for further research, particularly in the fields of pharmaceuticals and organic synthesis.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-6-2-3-9-8(6)10-4-7(5)11/h2-4,11H,1H3,(H,9,10)
InChI key:InChIKey=CUQWDSDBCSPLLX-UHFFFAOYSA-N
SMILES:CC1=C2C(=NC=C1O)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-5-ol, 4-methyl-
  • 4-Methyl-1H-pyrrolo[2,3-b]pyridin-5-ol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.