CAS 1190314-34-1

7-Methoxy-1H-pyrrolo[2,3-c]pyridin-3-amine

Description:

7-Methoxy-1H-pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique pyrrolo-pyridine structure, which incorporates both a pyrrole and a pyridine ring. This compound features a methoxy group (-OCH3) at the 7-position and an amino group (-NH2) at the 3-position of the pyrrolo ring, contributing to its potential biological activity. The presence of these functional groups may influence its solubility, reactivity, and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential roles as pharmaceuticals or in medicinal chemistry. The molecular structure suggests that it may participate in hydrogen bonding and other interactions due to the presence of the amino group, which can enhance its binding affinity to various receptors or enzymes. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the methoxy group and the overall aromatic character of the rings. Further studies would be necessary to elucidate its specific properties and potential applications.

Formula: C₈H₉N₃O

InChI: InChI=1S/C8H9N3O/c1-12-8-7-5(2-3-10-8)6(9)4-11-7/h2-4,11H,9H2,1H3

InChI key: InChIKey=VSZRJXQJWPRZTN-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(C(N)=CN2)=CC=N1

Synonyms:

• 7-Methoxy-1H-pyrrolo[2,3-c]pyridin-3-amine
• 1H-Pyrrolo[2,3-c]pyridin-3-amine, 7-methoxy-

1H-Pyrrolo[2,3-c]pyridin-3-amine, 7-methoxy-

CAS: 1190314-34-1

Formula: C₈H₉N₃O

Molecular weight: 163.1766

Ref: IN-DA000P4L