CymitQuimica logo

CAS 1190314-39-6

:

1,5-Dihydro-2-methyl-4H-pyrrolo[3,2-c]pyridin-4-one

Description:
1,5-Dihydro-2-methyl-4H-pyrrolo[3,2-c]pyridin-4-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes both pyrrole and pyridine rings. This compound features a dihydro-pyrrole moiety, contributing to its potential reactivity and biological activity. It typically exhibits a range of polar functional groups, which can influence its solubility in various solvents. The presence of a methyl group at the 2-position of the pyrrole ring can affect its electronic properties and steric hindrance, potentially impacting its interactions with biological targets. The compound may display interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for various substitution patterns, which can be explored for the development of derivatives with enhanced activity or selectivity. Overall, 1,5-Dihydro-2-methyl-4H-pyrrolo[3,2-c]pyridin-4-one represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-5-4-6-7(10-5)2-3-9-8(6)11/h2-4,10H,1H3,(H,9,11)
InChI key:InChIKey=YFGZWIDRAIDWEU-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(C)=C2)C=CN1
Synonyms:
  • 1,5-Dihydro-2-methyl-4H-pyrrolo[3,2-c]pyridin-4-one
  • 4H-Pyrrolo[3,2-c]pyridin-4-one, 1,5-dihydro-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.