CymitQuimica logo

CAS 1190314-48-7

:

4-Methoxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde

Description:
4-Methoxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine structures, which contribute to its unique chemical properties. This compound features a methoxy group (-OCH3) and an aldehyde functional group (-CHO) attached to a pyrrolo[2,3-b]pyridine framework. The presence of the methoxy group enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The aldehyde functionality allows for potential reactivity in condensation reactions and can serve as a precursor for various synthetic pathways. This compound may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in the synthesis of pharmaceuticals or agrochemicals. As with many heterocycles, the electronic properties imparted by the nitrogen atoms in the ring can affect its reactivity and stability, making it a valuable compound for further research in organic synthesis and medicinal applications.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-13-7-2-3-10-9-8(7)6(5-12)4-11-9/h2-5H,1H3,(H,10,11)
InChI key:InChIKey=GLFKFDQZTQWFIB-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=NC=CC2OC
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 4-methoxy-
  • 4-Methoxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.