CAS 1190314-62-5
:7-Iodo-1H-indazol-6-ol
Description:
7-Iodo-1H-indazol-6-ol is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 7-position and a hydroxyl group (-OH) at the 6-position contributes to its unique reactivity and potential biological activity. This compound may exhibit properties such as being a potential ligand in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The hydroxyl group can participate in hydrogen bonding, influencing solubility and interaction with biological macromolecules. Additionally, the iodine substituent can enhance the compound's lipophilicity and may play a role in its pharmacokinetic properties. As with many halogenated compounds, 7-Iodo-1H-indazol-6-ol may also exhibit interesting electronic properties due to the presence of the iodine atom. Overall, its structural features suggest potential applications in drug discovery and development, although specific biological activities would require further investigation through experimental studies.
Formula:C7H5IN2O
InChI:InChI=1S/C7H5IN2O/c8-6-5(11)2-1-4-3-9-10-7(4)6/h1-3,11H,(H,9,10)
InChI key:InChIKey=HIGYUIWCUJGUNV-UHFFFAOYSA-N
SMILES:IC1=C2C(=CC=C1O)C=NN2
Synonyms:- 1H-Indazol-6-ol, 7-iodo-
- 7-Iodo-1H-indazol-6-ol
- 6-Hydroxy-7-iodo-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
