CAS 1190314-65-8
:6-Bromo-1,3-dihydro-3-hydroxy-3-methyl-2H-indol-2-one
Description:
6-Bromo-1,3-dihydro-3-hydroxy-3-methyl-2H-indol-2-one is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a hydroxyl group at the 3-position contributes to its unique reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and may have specific interactions with biological targets due to its functional groups. The methyl group at the 3-position can influence its steric and electronic properties, potentially affecting its pharmacological profile. Compounds of this type are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogens and hydroxyl groups can enhance the compound's ability to participate in various chemical reactions, making it a subject of interest in synthetic organic chemistry and drug design.
Formula:C9H8BrNO2
InChI:InChI=1S/C9H8BrNO2/c1-9(13)6-3-2-5(10)4-7(6)11-8(9)12/h2-4,13H,1H3,(H,11,12)
InChI key:InChIKey=IGRQAUGYEAXYJY-UHFFFAOYSA-N
SMILES:CC1(O)C=2C(NC1=O)=CC(Br)=CC2
Synonyms:- 6-Bromo-3-hydroxy-3-methylindolin-2-one
- 6-Bromo-3-hydroxy-3-methyl-1,3-dihydro-indol-2-one
- 6-Bromo-1,3-dihydro-3-hydroxy-3-methyl-2H-indol-2-one
- 2H-Indol-2-one, 6-bromo-1,3-dihydro-3-hydroxy-3-methyl-
- 6-Bromo-3-hydroxy-3-methyl-1H-indol-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
