
CAS 1190314-66-9
:4-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
Description:
4-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a hydroxyl group (-OH) and an aldehyde group (-CHO), making it a versatile intermediate in organic synthesis. The presence of the hydroxyl group enhances its reactivity, allowing for potential applications in medicinal chemistry and the development of pharmaceuticals. The compound's structure suggests it may exhibit biological activity, possibly interacting with various biological targets due to its ability to form hydrogen bonds and engage in π-π stacking interactions. Additionally, its solubility in polar solvents may facilitate its use in various chemical reactions and formulations. As a relatively specialized compound, it may not be widely encountered outside of specific research contexts, particularly in studies related to pyrrole and pyridine derivatives. Overall, 4-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde represents a significant structure for further exploration in synthetic and medicinal chemistry.
Formula:C8H6N2O2
InChI:InChI=1S/C8H6N2O2/c11-4-5-3-10-8-7(5)6(12)1-2-9-8/h1-4H,(H2,9,10,12)
InChI key:InChIKey=OCFFEPKNSVAYCL-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=NC=CC2O
Synonyms:- 4-Hydroxy-1H-pyrrolo[2,3-b]pyridine-3-carboxaldehyde
- 1H-Pyrrolo[2,3-b]pyridine-3-carboxaldehyde, 4-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
