
CAS 1190314-71-6
:4-Fluoro-2-methyl-1H-pyrrolo[3,2-c]pyridine
Description:
4-Fluoro-2-methyl-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 4-position and a methyl group at the 2-position enhances its reactivity and influences its electronic properties. This compound typically exhibits moderate to high solubility in polar organic solvents, making it suitable for various synthetic applications. Its structure allows for potential interactions with biological targets, which may be of interest in medicinal chemistry and drug development. The compound's molecular framework can facilitate the formation of hydrogen bonds and π-π stacking interactions, which are important in biological systems. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, making it a valuable candidate for further research in pharmacology. Overall, 4-Fluoro-2-methyl-1H-pyrrolo[3,2-c]pyridine is a versatile compound with potential applications in both synthetic and medicinal chemistry.
Formula:C8H7FN2
InChI:InChI=1S/C8H7FN2/c1-5-4-6-7(11-5)2-3-10-8(6)9/h2-4,11H,1H3
InChI key:InChIKey=NALARTQSVBBUQJ-UHFFFAOYSA-N
SMILES:FC1=C2C(NC(C)=C2)=CC=N1
Synonyms:- 4-Fluoro-2-methyl-1H-pyrrolo[3,2-c]pyridine
- 1H-Pyrrolo[3,2-c]pyridine, 4-fluoro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
