CymitQuimica logo

CAS 1190314-76-1

:

7-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine

Description:
7-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position and a nitro group at the 3-position enhances its reactivity and potential biological activity. This compound typically exhibits a pale yellow to brownish appearance and is soluble in organic solvents, reflecting its aromatic nature. Its molecular structure allows for various interactions, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The nitro group can participate in reduction reactions, while the chlorine atom may serve as a site for further substitution reactions. Additionally, the compound's heterocyclic framework is known to influence its electronic properties, potentially affecting its behavior in biological systems. Overall, 7-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine is a versatile compound with applications in research and development within the fields of organic synthesis and drug discovery.
Formula:C7H4ClN3O2
InChI:InChI=1S/C7H4ClN3O2/c8-7-6-4(1-2-9-7)5(3-10-6)11(12)13/h1-3,10H
InChI key:InChIKey=GTJXLZPLEPDXLE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=C(Cl)N=CC2
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine, 7-chloro-3-nitro-
  • 7-Chloro-3-nitro-1H-pyrrolo[2,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.