CymitQuimica logo

CAS 1190314-93-2

:

3-Chloro-6-fluoro-1H-pyrrolo[3,2-c]pyridine

Description:
3-Chloro-6-fluoro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of chlorine and fluorine substituents at specific positions on the aromatic system enhances its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen atoms that can influence biological interactions. Additionally, the compound may exhibit interesting electronic properties due to the conjugated system formed by the fused rings. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as halogenated compounds can pose health risks.
Formula:C7H4ClFN2
InChI:InChI=1S/C7H4ClFN2/c8-5-3-10-6-1-7(9)11-2-4(5)6/h1-3,10H
InChI key:InChIKey=HGAWYYSMQYETQJ-UHFFFAOYSA-N
SMILES:ClC=1C=2C(NC1)=CC(F)=NC2
Synonyms:
  • 3-Chloro-6-fluoro-1H-pyrrolo[3,2-c]pyridine
  • 1H-Pyrrolo[3,2-c]pyridine, 3-chloro-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.