CAS 1190314-95-4

4-Fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

Description:

4-Fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of a fluorine atom at the 4-position of the pyrrole ring contributes to its chemical reactivity and potential biological activity. This compound features a carboxylic acid functional group at the 3-position, which enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, making it of interest in medicinal chemistry and drug design. Its specific properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other functional groups. Additionally, the compound may exhibit interesting pharmacological activities, which could be explored in various research contexts, particularly in the development of pharmaceuticals targeting specific biological pathways.

Formula: C₈H₅FN₂O₂

InChI: InChI=1S/C8H5FN2O2/c9-5-1-2-10-7-6(5)4(3-11-7)8(12)13/h1-3H,(H,10,11)(H,12,13)

InChI key: InChIKey=DKZKIAYGAZBOSQ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=NC=CC2F

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-fluoro-
• 4-Fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

4-Fluoro-1H-pyrrolo[2,3-b]pyridine-3-carboxylic acid

CAS: 1190314-95-4

Formula: C₈H₅FN₂O₂

Molecular weight: 180.1359

Ref: IN-DA000HN1