CymitQuimica logo

CAS 1190315-02-6

:

6-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine

Description:
6-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine ring fused together. The presence of a fluorine atom at the 6-position of the pyrrole ring contributes to its chemical reactivity and potential biological activity. This compound typically exhibits properties such as moderate solubility in polar solvents and may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions due to the presence of the amino group at the 3-position. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The compound's CAS number, 1190315-02-6, allows for its identification in chemical databases, facilitating research and development efforts. Overall, 6-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine represents a valuable scaffold for further exploration in drug discovery and material science.
Formula:C7H6FN3
InChI:InChI=1S/C7H6FN3/c8-7-1-6-4(2-11-7)5(9)3-10-6/h1-3,10H,9H2
InChI key:InChIKey=BREGIRIFLCIBJE-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=CC(F)=NC2
Synonyms:
  • 6-Fluoro-1H-pyrrolo[3,2-c]pyridin-3-amine
  • 1H-Pyrrolo[3,2-c]pyridin-3-amine, 6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.