CymitQuimica logo

CAS 1190315-06-0

:

3-Chloro-1H-pyrrolo[2,3-b]pyridin-4-amine

Description:
3-Chloro-1H-pyrrolo[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a chlorine atom at the 3-position and an amino group at the 4-position contributes to its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The chlorine substituent can influence the compound's electronic properties and steric effects, which may be relevant in drug design. Additionally, the compound's synthesis and characterization often involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, 3-Chloro-1H-pyrrolo[2,3-b]pyridin-4-amine is of interest for its potential applications in research and development within the field of medicinal chemistry.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-4-3-11-7-6(4)5(9)1-2-10-7/h1-3H,(H3,9,10,11)
InChI key:InChIKey=KUOFUICAGAGXGB-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=C1)NC=C2Cl
Synonyms:
  • 3-Chloro-1H-pyrrolo[2,3-b]pyridin-4-amine
  • 1H-Pyrrolo[2,3-b]pyridin-4-amine, 3-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.