CAS 1190315-17-3

4-Azido-6-methyl-1H-pyrrolo[2,3-b]pyridine

Description:

4-Azido-6-methyl-1H-pyrrolo[2,3-b]pyridine is a heterocyclic compound characterized by the presence of both azide and pyridine functional groups. This compound features a pyrrolo[2,3-b]pyridine core, which is a bicyclic structure known for its potential biological activity and utility in medicinal chemistry. The azido group (-N3) is a notable feature, often utilized in click chemistry and as a precursor for various chemical transformations. The methyl group at the 6-position contributes to the compound's overall stability and reactivity. This substance may exhibit interesting properties such as fluorescence or reactivity towards nucleophiles, making it a candidate for further research in drug development or material science. Its unique structure allows for potential applications in the synthesis of more complex molecules, and its azido functionality can facilitate conjugation reactions. As with many azide-containing compounds, safety precautions should be observed due to their potential sensitivity and explosive nature under certain conditions.

Formula: C₈H₇N₅

InChI: InChI=1S/C8H7N5/c1-5-4-7(12-13-9)6-2-3-10-8(6)11-5/h2-4H,1H3,(H,10,11)

InChI key: InChIKey=FRSAYEYAHWWVIM-UHFFFAOYSA-N

SMILES: N(=[N+]=[N-])C1=C2C(=NC(C)=C1)NC=C2

Synonyms:

• 4-Azido-6-methyl-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 4-azido-6-methyl-

1H-Pyrrolo[2,3-b]pyridine, 4-azido-6-methyl-

CAS: 1190315-17-3

Formula: C₈H₇N₅

Molecular weight: 173.1747

Ref: IN-DA000P4M