CymitQuimica logo

CAS 1190315-23-1

:

3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde

Description:
3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a nitro group (-NO2) at the 3-position and an aldehyde group (-CHO) at the 4-position enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic additions and electrophilic substitutions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with nitro-substituted heterocycles. Additionally, the compound's ability to participate in diverse chemical transformations makes it valuable in synthetic organic chemistry. Safety data should be consulted for handling, as nitro compounds can be sensitive to heat and shock, and the aldehyde group may pose reactivity concerns.
Formula:C8H5N3O3
InChI:InChI=1S/C8H5N3O3/c12-4-5-1-2-9-8-7(5)6(3-10-8)11(13)14/h1-4H,(H,9,10)
InChI key:InChIKey=LMDYNTQQNDTQHE-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=NC=CC2C=O
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 3-nitro-
  • 3-Nitro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.