CymitQuimica logo

CAS 1190315-26-4

:

4,5-Dichloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one

Description:
4,5-Dichloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 4 and 5 positions enhances its reactivity and may influence its biological activity. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics. Its structure includes a carbonyl group, which can participate in various chemical reactions, including nucleophilic attacks. The compound may be of interest in medicinal chemistry due to its potential pharmacological properties, as many pyrrolopyridine derivatives are known for their biological activities. Additionally, the presence of halogens can affect the compound's lipophilicity and metabolic stability. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4,5-Dichloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one represents a significant structure for further research in chemical and pharmaceutical applications.
Formula:C7H4Cl2N2O
InChI:InChI=1S/C7H4Cl2N2O/c8-4-2-10-7-3(6(4)9)1-5(12)11-7/h2H,1H2,(H,10,11,12)
InChI key:InChIKey=RVBQLMVNUYCDTF-UHFFFAOYSA-N
SMILES:ClC1=C2C(NC(=O)C2)=NC=C1Cl
Synonyms:
  • 2H-Pyrrolo[2,3-b]pyridin-2-one, 4,5-dichloro-1,3-dihydro-
  • 4,5-Dichloro-1,3-dihydro-2H-pyrrolo[2,3-b]pyridin-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.