
CAS 1190315-43-5
:3-Amino-1,6-dihydro-7H-pyrrolo[2,3-c]pyridin-7-one
Description:
3-Amino-1,6-dihydro-7H-pyrrolo[2,3-c]pyridin-7-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features an amino group, contributing to its potential as a building block in medicinal chemistry and drug development. The presence of the dihydro group indicates that the compound may exhibit reduced reactivity compared to fully aromatic systems, potentially influencing its biological activity. Its molecular structure suggests it may participate in hydrogen bonding and other interactions, making it a candidate for various applications, including as a ligand in coordination chemistry or as an intermediate in organic synthesis. The compound's solubility, stability, and reactivity can vary based on the functional groups present and the specific conditions under which it is handled. Overall, 3-Amino-1,6-dihydro-7H-pyrrolo[2,3-c]pyridin-7-one represents a versatile structure with potential implications in pharmacology and materials science.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-5-3-10-6-4(5)1-2-9-7(6)11/h1-3,10H,8H2,(H,9,11)
InChI key:InChIKey=ZWYGSPRXFKMCIF-UHFFFAOYSA-N
SMILES:O=C1C2=C(C(N)=CN2)C=CN1
Synonyms:- 7H-Pyrrolo[2,3-c]pyridin-7-one, 3-amino-1,6-dihydro-
- 3-Amino-1,6-dihydro-7H-pyrrolo[2,3-c]pyridin-7-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
