CAS 1190315-62-8

1-(5-Bromo-1H-indazol-3-yl)-2,2,2-trifluoroethanone

Description:

1-(5-Bromo-1H-indazol-3-yl)-2,2,2-trifluoroethanone is a chemical compound characterized by its unique structure, which includes an indazole ring substituted with a bromine atom and a trifluoroethanone moiety. The presence of the bromine atom enhances its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The trifluoroethanone group contributes to the compound's electrophilic nature, making it useful in various chemical reactions, including nucleophilic substitutions. This compound is likely to exhibit significant biological activity due to its structural features, which may interact with biological targets. Additionally, the trifluoromethyl group is known to influence lipophilicity and metabolic stability, potentially affecting the compound's pharmacokinetics. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and disposal. Overall, 1-(5-Bromo-1H-indazol-3-yl)-2,2,2-trifluoroethanone represents a valuable structure in the field of organic synthesis and drug discovery.

Formula: C₉H₄BrF₃N₂O

InChI: InChI=1S/C9H4BrF3N2O/c10-4-1-2-6-5(3-4)7(15-14-6)8(16)9(11,12)13/h1-3H,(H,14,15)

InChI key: InChIKey=QPQZDQCSYSAACT-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(=O)C=1C=2C(NN1)=CC=C(Br)C2

Synonyms:

• Ethanone, 1-(5-bromo-1H-indazol-3-yl)-2,2,2-trifluoro-
• 1-(5-Bromo-1H-indazol-3-yl)-2,2,2-trifluoroethanone