CAS 1190315-73-1

6-(Trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde

Description:

6-(Trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a pyridine and a pyrrole ring. The presence of a trifluoromethyl group (-CF3) significantly influences its chemical properties, enhancing its lipophilicity and potentially its reactivity. The aldehyde functional group (-CHO) at the 3-position contributes to its reactivity, making it a useful intermediate in organic synthesis. This compound is typically used in medicinal chemistry and material science due to its potential biological activity and ability to form various derivatives. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be advantageous in drug design. Additionally, the trifluoromethyl group can improve metabolic stability and bioavailability in pharmaceutical applications. Overall, this compound is of interest for its synthetic utility and potential applications in developing new therapeutic agents.

Formula: C₉H₅F₃N₂O

InChI: InChI=1S/C9H5F3N2O/c10-9(11,12)8-1-7-6(3-14-8)5(4-15)2-13-7/h1-4,13H

InChI key: InChIKey=AQBFPVBSGKIDJU-UHFFFAOYSA-N

SMILES: C(=O)C=1C=2C(=CC(C(F)(F)F)=NC2)NC1

Synonyms:

• 6-(Trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine-3-carboxaldehyde
• 1H-Pyrrolo[3,2-c]pyridine-3-carboxaldehyde, 6-(trifluoromethyl)-