CAS 1190315-75-3
:3-Iodo-4-methyl-7-nitro-1H-indazole
Description:
3-Iodo-4-methyl-7-nitro-1H-indazole is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. The presence of an iodine atom at the 3-position, a methyl group at the 4-position, and a nitro group at the 7-position contributes to its unique chemical properties. This compound is typically classified as a heterocyclic aromatic compound due to the presence of nitrogen atoms in its structure. The iodine substituent can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The nitro group is known for its electron-withdrawing properties, which can influence the compound's electronic characteristics and reactivity. Additionally, the methyl group can affect the steric and electronic environment around the indazole ring. Overall, 3-Iodo-4-methyl-7-nitro-1H-indazole is of interest in research for its potential biological activities and applications in organic synthesis.
Formula:C8H6IN3O2
InChI:InChI=1S/C8H6IN3O2/c1-4-2-3-5(12(13)14)7-6(4)8(9)11-10-7/h2-3H,1H3,(H,10,11)
InChI key:InChIKey=SQVJTICGTRLFPY-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(I)=NN2)=C(C)C=C1
Synonyms:- 1H-Indazole, 3-iodo-4-methyl-7-nitro-
- 3-Iodo-4-methyl-7-nitro-1H-indazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.