CymitQuimica logo

CAS 1190315-85-5

:

1,5-Dihydro-3-iodo-6H-pyrrolo[3,2-c]pyridin-6-one

Description:
1,5-Dihydro-3-iodo-6H-pyrrolo[3,2-c]pyridin-6-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of the iodine atom at the 3-position contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions. This compound features a carbonyl group, which enhances its electrophilic character, making it a candidate for further functionalization. Its molecular structure suggests potential biological activity, and compounds of this type are often investigated for their pharmacological properties. The compound's solubility and stability can vary depending on the solvent and conditions, which is essential for its application in synthetic chemistry and drug development. As with many heterocycles, it may exhibit interesting electronic properties due to the conjugation within the ring system. Overall, 1,5-Dihydro-3-iodo-6H-pyrrolo[3,2-c]pyridin-6-one represents a versatile scaffold for further chemical exploration and potential therapeutic applications.
Formula:C7H5IN2O
InChI:InChI=1S/C7H5IN2O/c8-5-3-9-6-1-7(11)10-2-4(5)6/h1-3,9H,(H,10,11)
InChI key:InChIKey=DDVYUYCETFUOAF-UHFFFAOYSA-N
SMILES:IC=1C=2C(NC1)=CC(=O)NC2
Synonyms:
  • 1,5-Dihydro-3-iodo-6H-pyrrolo[3,2-c]pyridin-6-one
  • 6H-Pyrrolo[3,2-c]pyridin-6-one, 1,5-dihydro-3-iodo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.