CAS 1190315-99-1: 8-Bromo-4-quinolinemethanol

Description:8-Bromo-4-quinolinemethanol is a chemical compound characterized by its quinoline structure, which features a bromine atom at the 8-position and a hydroxymethyl group at the 4-position of the quinoline ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the quinoline moiety, which is known for its pharmacological significance. The bromine substituent can influence the compound's reactivity and solubility, while the hydroxymethyl group may participate in hydrogen bonding, affecting its interactions in biological systems. 8-Bromo-4-quinolinemethanol may be utilized in various research applications, particularly in medicinal chemistry, where derivatives of quinoline are explored for their potential as therapeutic agents. Additionally, its unique structure may allow for further modifications to enhance its efficacy or selectivity in biological assays. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula:C₁₀H₈BrNO

InChI:InChI=1S/C10H8BrNO/c11-9-3-1-2-8-7(6-13)4-5-12-10(8)9/h1-5,13H,6H2

InChI key:InChIKey=FIRODXFCQOQZSE-UHFFFAOYSA-N

SMILES:BrC1=CC=CC=2C1=NC=CC2CO

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4-Quinolinemethanol, 8-bromo- REF: IN-DA000HO7CAS: 1190315-99-1	- - -	To inquire	Mon 03 Mar 25
(8-Bromoquinolin-4-yl)methanol REF: FT-Z15478CAS: 1190315-99-1	98%	To inquire	Tue 04 Mar 25
(8-Bromoquinolin-4-yl)methanol REF: 10-F042978CAS: 1190315-99-1	95.0%	To inquire	Tue 11 Mar 25
(8-Bromoquinolin-4-yl)Methanol REF: 3D-FB43214CAS: 1190315-99-1	Min. 95%	- - -	Discontinued product