CAS 1190315-99-1: 8-Bromo-4-quinolinemethanol
Description:8-Bromo-4-quinolinemethanol is a chemical compound characterized by its quinoline structure, which features a bromine atom at the 8-position and a hydroxymethyl group at the 4-position of the quinoline ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the quinoline moiety, which is known for its pharmacological significance. The bromine substituent can influence the compound's reactivity and solubility, while the hydroxymethyl group may participate in hydrogen bonding, affecting its interactions in biological systems. 8-Bromo-4-quinolinemethanol may be utilized in various research applications, particularly in medicinal chemistry, where derivatives of quinoline are explored for their potential as therapeutic agents. Additionally, its unique structure may allow for further modifications to enhance its efficacy or selectivity in biological assays. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H8BrNO
InChI:InChI=1S/C10H8BrNO/c11-9-3-1-2-8-7(6-13)4-5-12-10(8)9/h1-5,13H,6H2
InChI key:InChIKey=FIRODXFCQOQZSE-UHFFFAOYSA-N
SMILES:BrC1=CC=CC=2C1=NC=CC2CO
- Synonyms:
- 8-Bromo-4-quinolinemethanol
- 4-Quinolinemethanol, 8-bromo-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-Quinolinemethanol, 8-bromo- REF: IN-DA000HO7CAS: 1190315-99-1 | - - - | To inquire | Wed 26 Mar 25 |
![]() | (8-Bromoquinolin-4-yl)methanol REF: FT-Z15478CAS: 1190315-99-1 | 98% | To inquire | Mon 31 Mar 25 |
![]() | (8-Bromoquinolin-4-yl)methanol REF: 10-F042978CAS: 1190315-99-1 | 95.0% | To inquire | Mon 07 Apr 25 |
![]() | (8-Bromoquinolin-4-yl)Methanol REF: 3D-FB43214CAS: 1190315-99-1 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA000HO7
Undefined size | To inquire |

Ref: FT-Z15478
1g | To inquire | ||
250mg | To inquire |

Ref: 10-F042978
1g | To inquire | ||
250mg | To inquire |

(8-Bromoquinolin-4-yl)Methanol
Ref: 3D-FB43214
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |