CymitQuimica logo

CAS 1190316-00-7

:

3-Amino-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one

Description:
3-Amino-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. This compound features an amino group, contributing to its potential as a building block in medicinal chemistry and drug development. The presence of the dihydro group indicates that it has a saturated bond within the ring system, which can influence its reactivity and stability. The compound is likely to exhibit various chemical properties, including the ability to participate in hydrogen bonding due to the amino group, and it may also engage in electrophilic or nucleophilic reactions depending on the functional groups present. Its structural features suggest potential biological activity, making it of interest in pharmacological research. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of substituents. Overall, 3-Amino-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one represents a versatile scaffold for further chemical exploration.
Formula:C7H7N3O
InChI:InChI=1S/C7H7N3O/c8-5-3-9-6-1-7(11)10-2-4(5)6/h1-3,9H,8H2,(H,10,11)
InChI key:InChIKey=XFXOFVSXJFLNQP-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=CC(=O)NC2
Synonyms:
  • 6H-Pyrrolo[3,2-c]pyridin-6-one, 3-amino-1,5-dihydro-
  • 3-Amino-1,5-dihydro-6H-pyrrolo[3,2-c]pyridin-6-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.