CAS 1190316-13-2

1,5-Dihydro-2-methyl-6H-pyrrolo[3,2-c]pyridin-6-one

Description:

1,5-Dihydro-2-methyl-6H-pyrrolo[3,2-c]pyridin-6-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine functionalities. This compound features a dihydropyrrole ring fused to a pyridine ring, contributing to its potential biological activity. The presence of a methyl group at the 2-position enhances its lipophilicity, which may influence its interaction with biological targets. The compound is typically studied for its potential pharmacological properties, including antimicrobial and anticancer activities, due to the presence of nitrogen atoms in its structure that can participate in various chemical interactions. Its CAS number, 1190316-13-2, allows for easy identification in chemical databases. As with many heterocycles, the compound's reactivity and stability can be influenced by the electronic properties of the nitrogen atoms and the overall molecular geometry. Further research is often required to fully elucidate its properties and potential applications in medicinal chemistry.

Formula: C₈H₈N₂O

InChI: InChI=1S/C8H8N2O/c1-5-2-6-4-9-8(11)3-7(6)10-5/h2-4,10H,1H3,(H,9,11)

InChI key: InChIKey=WGTHVYXGOGEBRI-UHFFFAOYSA-N

SMILES: CC1=CC=2C(N1)=CC(=O)NC2

Synonyms:

• 1,5-Dihydro-2-methyl-6H-pyrrolo[3,2-c]pyridin-6-one
• 6H-Pyrrolo[3,2-c]pyridin-6-one, 1,5-dihydro-2-methyl-

6H-Pyrrolo[3,2-c]pyridin-6-one, 1,5-dihydro-2-methyl-

CAS: 1190316-13-2

Formula: C₈H₈N₂O

Molecular weight: 148.1619

Ref: IN-DA000HPE