CAS 1190316-20-1
:6-Chloro-3-nitro-1H-pyrrolo[3,2-c]pyridine
Description:
6-Chloro-3-nitro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a nitro group at the 3-position enhances its reactivity and potential for various chemical transformations. This compound typically exhibits moderate solubility in polar organic solvents, and its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The nitro group can serve as a site for further functionalization, while the chlorine atom may influence the compound's lipophilicity and biological activity. Additionally, the compound's molecular framework may exhibit interesting electronic properties, making it a candidate for studies in materials science or as a building block in organic synthesis. Overall, 6-Chloro-3-nitro-1H-pyrrolo[3,2-c]pyridine is a versatile compound with potential applications across various fields of chemistry.
Formula:C7H4ClN3O2
InChI:InChI=1S/C7H4ClN3O2/c8-7-1-5-4(2-10-7)6(3-9-5)11(12)13/h1-3,9H
InChI key:InChIKey=ALPPQTCXGMTAHU-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(NC1)=CC(Cl)=NC2
Synonyms:- 1H-Pyrrolo[3,2-c]pyridine, 6-chloro-3-nitro-
- 6-Chloro-3-nitro-1H-pyrrolo[3,2-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
