
CAS 1190316-22-3
:3-Nitro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
Description:
3-Nitro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrole and pyridine moiety. The presence of a nitro group at the 3-position and a cyano group at the 7-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. The nitro and cyano functional groups can participate in various chemical reactions, including nucleophilic substitutions and reductions, which may be exploited in synthetic pathways. Additionally, the compound's unique structural features may impart specific pharmacological properties, warranting further investigation into its biological activity and potential therapeutic uses. As with many nitro-containing compounds, care should be taken regarding its handling and storage due to potential toxicity and environmental impact.
Formula:C8H4N4O2
InChI:InChI=1S/C8H4N4O2/c9-3-5-1-2-10-8-6(12(13)14)4-11-7(5)8/h1-2,4,11H
InChI key:InChIKey=ULGGLRJTKCCWPW-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=2C(=C(C#N)C=CN2)NC1
Synonyms:- 3-Nitro-1H-pyrrolo[3,2-b]pyridine-7-carbonitrile
- 1H-Pyrrolo[3,2-b]pyridine-7-carbonitrile, 3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
