CAS 1190316-32-5
:6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-amine
Description:
6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features a methyl group at the 6-position of the pyrrole ring and an amino group at the 3-position of the pyridine ring, influencing its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular framework allows for various functionalizations, which can enhance its pharmacological properties. Additionally, the presence of nitrogen atoms in the rings may contribute to its ability to form hydrogen bonds, affecting its interactions in biological systems. Overall, 6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-amine is a compound with promising characteristics for further research in chemical and pharmaceutical applications.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-2-7-8(11-3-5)6(9)4-10-7/h2-4,10H,9H2,1H3
InChI key:InChIKey=TXFMWOPWSPFYMO-UHFFFAOYSA-N
SMILES:NC=1C=2C(NC1)=CC(C)=CN2
Synonyms:- 6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-amine
- 1H-Pyrrolo[3,2-b]pyridin-3-amine, 6-methyl-
- 3-AMino-6-Methyl-4-azaindole
- 6-Methyl-1H-pyrrolo[3,2-b]pyridin-3-ylamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
