CymitQuimica logo

CAS 1190316-40-5

:

3-Chloro-6-methoxy-1H-pyrrolo[3,2-b]pyridine

Description:
3-Chloro-6-methoxy-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole functionalities. This compound features a chlorine atom and a methoxy group, which contribute to its chemical reactivity and potential biological activity. The presence of the chlorine atom can enhance lipophilicity, while the methoxy group may influence solubility and electronic properties. Typically, compounds of this class are investigated for their pharmacological properties, including potential applications in medicinal chemistry as they may exhibit activity against various biological targets. The molecular structure allows for various substitution patterns, which can affect the compound's interaction with enzymes or receptors. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-Chloro-6-methoxy-1H-pyrrolo[3,2-b]pyridine represents a class of compounds with significant interest in research and development within the fields of organic and medicinal chemistry.
Formula:C8H7ClN2O
InChI:InChI=1S/C8H7ClN2O/c1-12-5-2-7-8(11-3-5)6(9)4-10-7/h2-4,10H,1H3
InChI key:InChIKey=QCQOEPCNIMSWGM-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CC(OC)=CN2)NC1
Synonyms:
  • 3-Chloro-6-methoxy-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 3-chloro-6-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.